Database / Pharmaceutical impurity
Pharmaceutical impurityPhenytoin Imp. B (EP): Diphenylethanedione (Benzil)
Phenytoin Imp. B (EP): Diphenylethanedione (Benzil) is listed in the pharmaceutical impurity collection under CAS 134-81-6. Its represented structure has formula C14H10O2 and a calculated molecular weight of 210.23 g/mol.
2D chemical structure
Chemical identity
- Catalog name
- Phenytoin Imp. B (EP): Diphenylethanedione (Benzil)
- Common name
- Phenytoin Imp. B (EP)
- Chemical name
- Diphenylethanedione (Benzil)
- CAS
- 134-81-6
- SMILES
- O=C(C(=O)c1ccccc1)c1ccccc1
- InChI
- InChI=1S/C14H10O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H
- InChIKey
- WURBFLDFSFBTLW-UHFFFAOYSA-N
- Associated API
- Phenytoin
Record ID: A4474bc7456f9
Computed properties
C14H10O2 Molecular formula
210.232 g/molMolecular weight
210.0681 DaMonoisotopic exact mass
34.14 ŲTopological polar surface area
2.7522 Calculated LogP (Wildman–Crippen)
61.545 cm³/molMolar refractivity (Wildman–Crippen)
2 countHydrogen-bond acceptors
0 countHydrogen-bond donors
Descriptors are calculated from the displayed SMILES. Calculated LogP is not a measured partition coefficient or a pH-specific LogD.
Molecular descriptor profile
Structural feature counts
Element composition
Radar scale: 0–100 percentile within 25,771 distinct represented structures in this release, using the midpoint rank for ties. Larger values indicate a higher descriptor rank, not greater safety or toxicity. Element counts include hydrogen and combine isotopes under each element.
Radar values and percentile reference
| Descriptor | Value | Percentile |
|---|---|---|
| Molecular weight | 210.232 | 20.03 |
| Calculated LogP (Wildman–Crippen) | 2.7522 | 56.95 |
| Topological polar surface area | 34.14 | 16.37 |
| Hydrogen-bond acceptors | 2 | 15.92 |
| Hydrogen-bond donors | 0 | 11.28 |
| Rotatable bonds (strict) | 3 | 37.08 |
Complete molecular descriptors
| Property | Calculated value | Unit / type |
|---|---|---|
| Molecular formula | C14H10O2 | dimensionless |
| Molecular weight | 210.232 | g/mol |
| Monoisotopic exact mass | 210.0681 | Da |
| Topological polar surface area | 34.14 | Ų |
| Calculated LogP (Wildman–Crippen) | 2.7522 | dimensionless |
| Molar refractivity (Wildman–Crippen) | 61.545 | cm³/mol |
| Hydrogen-bond acceptors | 2 | count |
| Hydrogen-bond donors | 0 | count |
| Rotatable bonds (strict) | 3 | count |
| Heavy atoms | 16 | count |
| Heteroatoms | 2 | count |
| Rings | 2 | count |
| Aromatic rings | 2 | count |
| Aliphatic rings | 0 | count |
| Saturated rings | 0 | count |
| Aromatic heterocycles | 0 | count |
| Aliphatic heterocycles | 0 | count |
| Saturated heterocycles | 0 | count |
| Aromatic carbocycles | 2 | count |
| Aliphatic carbocycles | 0 | count |
| Fraction of sp³ carbon atoms | 0 | fraction |
| Formal charge | 0 | e |
| Disconnected components | 1 | count |
| Isotopically specified atoms | 0 | count |
| Potential atom stereocenters | 0 | count |
| Unspecified atom stereocenters | 0 | count |
| Spiro atoms | 0 | count |
| Bridgehead atoms | 0 | count |
| Labute approximate surface area | 93.5414 | Ų |
| Valence electrons | 78 | count |
| Radical electrons | 0 | count |
| Bertz complexity | 451.2733 | index |
| Balaban J | 2.2786 | index |
Ring categories overlap and should not be summed. No toxicity result, PDE, HBEL or acceptable intake is inferred from these descriptors.
Toxicological services and resources for Phenytoin Imp. B (EP): Diphenylethanedione (Benzil)
Qualification and safety assessment of Phenytoin Imp. B (EP): Diphenylethanedione (Benzil)
Explore toxicological qualification of Phenytoin Imp. B (EP): Diphenylethanedione (Benzil) and ICH M7 mutagenic impurity assessment of Phenytoin Imp. B (EP): Diphenylethanedione (Benzil) for evaluation of this impurity in its pharmaceutical context.
Where data gaps need to be addressed, resources include read-across assessment for Phenytoin Imp. B (EP): Diphenylethanedione (Benzil) and acceptable intake and limit justification for Phenytoin Imp. B (EP): Diphenylethanedione (Benzil). The relevant approach depends on the available evidence, exposure and duration of use.
Related Altox services and technical resources
- ICH M7 Mutagenic Impurity Assessment
- Genotoxic Impurity Risk Assessment
- (Q)SAR Mutagenicity Assessment
- Mutagenic and Non-Mutagenic Impurity Assessment
- Toxicological Qualification of Impurities and Degradation Products
- Toxicological Read-Across Assessment
- Impurity Specification Setting and Limit Justification
- Acceptable Intake (AI) Assessment and Limit Derivation
Other catalogue designations with the same represented structure
These are separate catalogue entries; shared structure does not establish interchangeable pharmacopoeial designations.
Identity sources and calculation method
Identifiers originate from the source catalogues and available public identity records. InChI and InChIKey on this page are generated from the displayed SMILES. RDKit validation checks the molecular representation; it does not independently verify every catalogue assignment.
Discuss an assessment for Phenytoin Imp. B (EP): Diphenylethanedione (Benzil)
Explore Altox services and software through the Altox Pharma-Hub.